CAS 926238-86-0

3-Amino-4-chloro-N-[2-(dimethylamino)ethyl]benzamide

Description:

3-Amino-4-chloro-N-[2-(dimethylamino)ethyl]benzamide is a chemical compound characterized by its specific functional groups and structural features. It contains an amino group (-NH2), a chloro substituent (-Cl), and a benzamide moiety, which is indicative of its potential as a pharmaceutical or biochemical agent. The presence of the dimethylamino group suggests that it may exhibit basic properties, influencing its solubility and reactivity. This compound is likely to be a solid at room temperature, with a molecular structure that allows for various interactions, such as hydrogen bonding and van der Waals forces. Its unique combination of functional groups may impart biological activity, making it of interest in medicinal chemistry. Additionally, the chlorine atom can enhance lipophilicity, potentially affecting the compound's pharmacokinetics. Safety and handling precautions should be observed due to the presence of chlorine and amine groups, which can be reactive. Overall, this compound's characteristics make it a subject of interest for further research and application in various chemical and biological contexts.

Formula: C₁₁H₁₆ClN₃O

InChI: InChI=1S/C11H16ClN3O/c1-15(2)6-5-14-11(16)8-3-4-9(12)10(13)7-8/h3-4,7H,5-6,13H2,1-2H3,(H,14,16)

InChI key: InChIKey=NYFBRISXVALGRA-UHFFFAOYSA-N

SMILES: C(NCCN(C)C)(=O)C1=CC(N)=C(Cl)C=C1

Synonyms:

• Benzamide, 3-amino-4-chloro-N-[2-(dimethylamino)ethyl]-
• 3-Amino-4-chloro-N-[2-(dimethylamino)ethyl]benzamide