CymitQuimica logo

CAS 926238-94-0

:

1-(methoxyacetyl)piperidine-3-carboxylic acid

Description:
1-(Methoxyacetyl)piperidine-3-carboxylic acid is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. The presence of a methoxyacetyl group and a carboxylic acid functional group contributes to its unique chemical properties. This compound is likely to exhibit moderate polarity due to the presence of both the methoxy and carboxylic acid groups, which can participate in hydrogen bonding. The piperidine moiety may influence its basicity and reactivity, making it a potential candidate for various chemical reactions, including acylation and esterification. Additionally, the compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological targets. Its solubility in polar solvents and stability under standard conditions are also important characteristics to consider for practical applications. Overall, 1-(methoxyacetyl)piperidine-3-carboxylic acid represents a versatile structure with potential utility in both synthetic and medicinal chemistry.
Formula:C9H15NO4
InChI:InChI=1/C9H15NO4/c1-14-6-8(11)10-4-2-3-7(5-10)9(12)13/h7H,2-6H2,1H3,(H,12,13)
SMILES:COCC(=O)N1CCCC(C1)C(=O)O
Synonyms:
  • 3-Piperidinecarboxylic Acid, 1-(2-Methoxyacetyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.