CymitQuimica logo

CAS 926239-48-7

:

4-(2-Amino-4-chlorophenyl)-2-piperazinone

Description:
4-(2-Amino-4-chlorophenyl)-2-piperazinone is a chemical compound characterized by its piperazinone structure, which includes a piperazine ring and an amino-substituted aromatic moiety. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of amino and carbonyl functional groups, which can engage in hydrogen bonding. The chlorophenyl group contributes to its potential biological activity, as halogenated aromatic compounds often exhibit unique pharmacological properties. The presence of the amino group may enhance its reactivity and ability to form various derivatives. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could interact with biological targets. Additionally, its molecular structure suggests potential applications in research related to neuropharmacology or as a scaffold for drug design. However, specific biological activities and safety profiles would require further investigation through experimental studies.
Formula:C10H12ClN3O
InChI:InChI=1S/C10H12ClN3O/c11-7-1-2-9(8(12)5-7)14-4-3-13-10(15)6-14/h1-2,5H,3-4,6,12H2,(H,13,15)
InChI key:InChIKey=SXECEUOBWJQWHM-UHFFFAOYSA-N
SMILES:NC1=C(N2CC(=O)NCC2)C=CC(Cl)=C1
Synonyms:
  • 2-Piperazinone, 4-(2-amino-4-chlorophenyl)-
  • 4-(2-Amino-4-chlorophenyl)-2-piperazinone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.