CAS 926243-94-9

N-(3-Amino-4-chlorophenyl)-3-chlorobenzamide

Description:

N-(3-Amino-4-chlorophenyl)-3-chlorobenzamide, identified by its CAS number 926243-94-9, is an organic compound characterized by its amide functional group, which is formed from the reaction of an amine and a carboxylic acid. This compound features a chlorinated aromatic system, with both a 3-amino-4-chlorophenyl group and a 3-chlorobenzamide moiety, contributing to its potential biological activity. The presence of chlorine atoms in the structure can influence its lipophilicity and reactivity, making it of interest in medicinal chemistry and drug development. The amino group may participate in hydrogen bonding, enhancing its solubility in polar solvents. Additionally, the compound's structural features suggest potential applications in pharmaceuticals, particularly in the development of agents targeting specific biological pathways. As with many chlorinated compounds, considerations regarding environmental impact and toxicity are essential in its handling and application. Overall, N-(3-Amino-4-chlorophenyl)-3-chlorobenzamide represents a complex molecule with diverse chemical properties and potential utility in various fields.

Formula: C₁₃H₁₀Cl₂N₂O

InChI: InChI=1S/C13H10Cl2N2O/c14-9-3-1-2-8(6-9)13(18)17-10-4-5-11(15)12(16)7-10/h1-7H,16H2,(H,17,18)

InChI key: InChIKey=SHAQDYYAQVARDG-UHFFFAOYSA-N

SMILES: N(C(=O)C1=CC(Cl)=CC=C1)C2=CC(N)=C(Cl)C=C2

Synonyms:

• N-(3-Amino-4-chlorophenyl)-3-chlorobenzamide
• Benzamide, N-(3-amino-4-chlorophenyl)-3-chloro-