CAS 926246-53-9

1-(1-Oxopropyl)-3-piperidinecarboxylic acid

Description:

1-(1-Oxopropyl)-3-piperidinecarboxylic acid, with the CAS number 926246-53-9, is a chemical compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of the 1-oxopropyl group indicates that it has a ketone functionality adjacent to the piperidine, which can influence its chemical behavior and interactions. Typically, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The molecular structure suggests that it could participate in hydrogen bonding due to the carboxylic acid group, enhancing its solubility in polar solvents. Additionally, the piperidine moiety may contribute to the compound's ability to interact with biological targets, potentially affecting its pharmacological properties. Overall, this compound's unique structure and functional groups make it a subject of interest for further research in various chemical and biological applications.

Formula: C₉H₁₅NO₃

InChI: InChI=1S/C9H15NO3/c1-2-8(11)10-5-3-4-7(6-10)9(12)13/h7H,2-6H2,1H3,(H,12,13)

InChI key: InChIKey=OHZLEWCRNCMLGD-UHFFFAOYSA-N

SMILES: C(CC)(=O)N1CC(C(O)=O)CCC1

Synonyms:

• 1-(1-Oxopropyl)-3-piperidinecarboxylic acid
• 1-Propionyl-3-piperidinecarboxylic acid
• 1-Propionyl-piperidine-3-carboxylic acid
• 1-Propionylpiperidine-3-carboxylic acid
• 3-Piperidinecarboxylic Acid, 1-(1-Oxopropyl)-
• 1-Propanoylpiperidine-3-carboxylic acid