CAS 926247-29-2

2-[(2-Furanylmethyl)amino]thiazolo[4,5-d]pyrimidin-7(6H)-one

Description:

2-[(2-Furanylmethyl)amino]thiazolo[4,5-d]pyrimidin-7(6H)-one is a heterocyclic compound characterized by its complex structure, which includes a thiazole ring fused to a pyrimidine moiety. This compound features a furan ring attached via a methylene bridge to an amino group, contributing to its unique reactivity and potential biological activity. The presence of both thiazole and pyrimidine rings suggests that it may exhibit interesting pharmacological properties, possibly acting as an inhibitor or modulator in various biochemical pathways. The compound's molecular structure allows for potential interactions with biological targets, making it a candidate for further research in medicinal chemistry. Additionally, its solubility and stability in various solvents can influence its application in drug formulation. As with many heterocycles, the electronic properties imparted by the nitrogen and sulfur atoms in the rings can affect its reactivity and interaction with other molecules. Overall, this compound represents a class of substances that may hold promise in therapeutic applications, warranting further investigation into its properties and potential uses.

Formula: C₁₀H₈N₄O₂S

InChI: InChI=1S/C10H8N4O2S/c15-9-7-8(12-5-13-9)14-10(17-7)11-4-6-2-1-3-16-6/h1-3,5H,4H2,(H2,11,12,13,14,15)

InChI key: InChIKey=CFPPMUCGINJTJT-UHFFFAOYSA-N

SMILES: O=C1C2=C(N=C(NCC3=CC=CO3)S2)NC=N1

Synonyms:

• Thiazolo[4,5-d]pyrimidin-7(6H)-one, 2-[(2-furanylmethyl)amino]-
• 2-[(2-Furanylmethyl)amino]thiazolo[4,5-d]pyrimidin-7(6H)-one

2-[(Furan-2-ylmethyl)amino]-6H,7H-[1,3]thiazolo[4,5-d]pyrimidin-7-one

CAS: 926247-29-2

Versatile small molecule scaffold

Formula: C₁₀H₈N₄O₂S

Purity: Min. 95%

Molecular weight: 248.26 g/mol

Ref: 3D-BMB24729