
CAS 926247-35-0
:4-Amino-N-(1-methylethyl)-1-piperidineacetamide
Description:
4-Amino-N-(1-methylethyl)-1-piperidineacetamide, also known by its CAS number 926247-35-0, is a chemical compound characterized by its piperidine structure, which includes an amino group and an acetamide functional group. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of the amino and acetamide groups. The presence of the isopropyl group (1-methylethyl) contributes to its hydrophobic characteristics, influencing its interaction with biological systems. It may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting specific receptors or pathways. The compound's molecular structure suggests it could participate in hydrogen bonding, which is crucial for its reactivity and interaction with other molecules. As with many amides, it may also display stability under various conditions, although specific stability and reactivity would depend on the surrounding environment and conditions.
Formula:C10H21N3O
InChI:InChI=1S/C10H21N3O/c1-8(2)12-10(14)7-13-5-3-9(11)4-6-13/h8-9H,3-7,11H2,1-2H3,(H,12,14)
InChI key:InChIKey=PESYFYBICDURCT-UHFFFAOYSA-N
SMILES:C(C(NC(C)C)=O)N1CCC(N)CC1
Synonyms:- 1-Piperidineacetamide, 4-amino-N-(1-methylethyl)-
- 4-Amino-N-(1-methylethyl)-1-piperidineacetamide
- 2-(4-Aminopiperidin-1-yl)-N-(propan-2-yl)acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.