CymitQuimica logo

CAS 926255-02-9

:

N-(3-Aminophenyl)-1,3-benzodioxole-5-carboxamide

Description:
N-(3-Aminophenyl)-1,3-benzodioxole-5-carboxamide, identified by its CAS number 926255-02-9, is a chemical compound characterized by its complex structure, which includes a benzodioxole moiety and an amine functional group. This compound typically exhibits properties associated with both aromatic and amine functionalities, contributing to its potential reactivity and solubility in various solvents. The presence of the carboxamide group suggests that it may engage in hydrogen bonding, influencing its physical properties such as melting point and solubility. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural features may allow for interactions with biological targets, potentially leading to therapeutic applications. However, specific characteristics such as exact melting point, boiling point, and solubility would require empirical data for precise determination. Overall, N-(3-Aminophenyl)-1,3-benzodioxole-5-carboxamide represents a compound with significant potential for research and application in various fields of chemistry and pharmacology.
Formula:C14H12N2O3
InChI:InChI=1S/C14H12N2O3/c15-10-2-1-3-11(7-10)16-14(17)9-4-5-12-13(6-9)19-8-18-12/h1-7H,8,15H2,(H,16,17)
InChI key:InChIKey=XJPHMHYWXDGFFO-UHFFFAOYSA-N
SMILES:C(NC1=CC(N)=CC=C1)(=O)C=2C=C3C(=CC2)OCO3
Synonyms:
  • 1,3-Benzodioxole-5-carboxamide, N-(3-aminophenyl)-
  • N-(3-Aminophenyl)-1,3-benzodioxole-5-carboxamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.