CAS 926255-60-9
:N-[3-(4-Morpholinyl)propyl]-4-piperidinecarboxamide
Description:
N-[3-(4-Morpholinyl)propyl]-4-piperidinecarboxamide, with the CAS number 926255-60-9, is a chemical compound characterized by its complex structure, which includes a piperidine ring and a morpholine moiety. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of amide and morpholine functional groups. It may demonstrate biological activity, potentially acting as a ligand for various receptors or enzymes, which makes it of interest in medicinal chemistry and pharmacology. The presence of both morpholine and piperidine rings suggests that it may interact with biological systems in a specific manner, possibly influencing its pharmacokinetic and pharmacodynamic profiles. Additionally, the compound's molecular structure may confer stability and specificity in its interactions, making it a candidate for further research in drug development. As with many chemical substances, safety data and handling precautions should be considered when working with this compound in a laboratory setting.
Formula:C13H25N3O2
InChI:InChI=1S/C13H25N3O2/c17-13(12-2-5-14-6-3-12)15-4-1-7-16-8-10-18-11-9-16/h12,14H,1-11H2,(H,15,17)
InChI key:InChIKey=XCIAJKZQODAPLQ-UHFFFAOYSA-N
SMILES:C(NCCCN1CCOCC1)(=O)C2CCNCC2
Synonyms:- 4-Piperidinecarboxamide, N-[3-(4-morpholinyl)propyl]-
- N-[3-(4-Morpholinyl)propyl]-4-piperidinecarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.