CAS 926256-14-6
:4-amino-2-chloro-N-(propan-2-yl)benzamide
Description:
4-Amino-2-chloro-N-(propan-2-yl)benzamide is an organic compound characterized by its amide functional group, which is linked to a benzene ring substituted with an amino group and a chlorine atom. The presence of the amino group (-NH2) indicates that it can participate in hydrogen bonding, potentially enhancing its solubility in polar solvents. The chlorine atom introduces a halogen, which can influence the compound's reactivity and stability. The isopropyl group (propan-2-yl) attached to the nitrogen atom contributes to the steric bulk of the molecule, which may affect its biological activity and interactions with other molecules. This compound may exhibit properties typical of amides, such as moderate melting and boiling points, and it may be involved in various chemical reactions, including nucleophilic substitutions and coupling reactions. Its specific applications and behavior would depend on its structural features and the context in which it is used, such as in pharmaceuticals or agrochemicals.
Formula:C10H13ClN2O
InChI:InChI=1/C10H13ClN2O/c1-6(2)13-10(14)8-4-3-7(12)5-9(8)11/h3-6H,12H2,1-2H3,(H,13,14)
SMILES:CC(C)N=C(c1ccc(cc1Cl)N)O
Synonyms:- 4-Amino-2-chloro-N-isopropylbenzamide
- Benzamide, 4-amino-2-chloro-N-(1-methylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
