CAS 926257-89-8

3-(4-Methoxyphenyl)-1-phenyl-1H-pyrazole-5-carboxylic acid

Description:

3-(4-Methoxyphenyl)-1-phenyl-1H-pyrazole-5-carboxylic acid is an organic compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of the 4-methoxyphenyl and phenyl substituents enhances its aromatic character, which can influence its solubility and interaction with biological systems. The methoxy group can also affect the compound's electronic properties, potentially enhancing its lipophilicity. This compound may exhibit interesting pharmacological activities due to its structural features, making it a subject of interest in medicinal chemistry. Its CAS number, 926257-89-8, allows for precise identification in chemical databases and literature. Overall, the combination of its functional groups and aromatic systems suggests potential applications in drug development or as a chemical probe in biological research.

Formula: C₁₇H₁₄N₂O₃

InChI: InChI=1S/C17H14N2O3/c1-22-14-9-7-12(8-10-14)15-11-16(17(20)21)19(18-15)13-5-3-2-4-6-13/h2-11H,1H3,(H,20,21)

InChI key: InChIKey=YTJXONHYADVNTC-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1N(N=C(C1)C2=CC=C(OC)C=C2)C3=CC=CC=C3

Synonyms:

• 3-(4-Methoxyphenyl)-1-phenyl-1H-pyrazole-5-carboxylic acid
• 1H-Pyrazole-5-carboxylic acid, 3-(4-methoxyphenyl)-1-phenyl-

3-(4-Methoxyphenyl)-1-phenyl-1H-pyrazole-5-carboxylic acid

Controlled Product

CAS: 926257-89-8

Versatile small molecule scaffold

Formula: C₁₇H₁₄N₂O₃

Purity: Min. 95%

Molecular weight: 294.3 g/mol

Ref: 3D-BMB25789