CAS 926259-66-7

3-(1-Azetidinylsulfonyl)-4-fluorobenzoic acid

Description:

3-(1-Azetidinylsulfonyl)-4-fluorobenzoic acid is a chemical compound characterized by its unique structure, which includes a benzoic acid moiety substituted with a fluorine atom and an azetidine ring linked through a sulfonyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and biological activity. The presence of the sulfonyl group enhances its solubility in polar solvents, while the fluorine atom can influence its electronic properties and lipophilicity. As a benzoic acid derivative, it may exhibit acidic behavior, allowing it to participate in various chemical reactions, including esterification and amidation. The azetidine ring can introduce strain and steric hindrance, potentially affecting the compound's interaction with biological targets. Overall, this compound may be of interest in medicinal chemistry for its potential pharmacological applications, particularly in the development of new therapeutic agents. However, specific biological activity and safety profiles would require further investigation through experimental studies.

Formula: C₁₀H₁₀FNO₄S

InChI: InChI=1S/C10H10FNO4S/c11-8-3-2-7(10(13)14)6-9(8)17(15,16)12-4-1-5-12/h2-3,6H,1,4-5H2,(H,13,14)

InChI key: InChIKey=HFNUPRVSIAWKLK-UHFFFAOYSA-N

SMILES: S(=O)(=O)(C1=CC(C(O)=O)=CC=C1F)N2CCC2

Synonyms:

• 3-(1-Azetidinylsulfonyl)-4-fluorobenzoic acid
• Benzoic acid, 3-(1-azetidinylsulfonyl)-4-fluoro-