CAS 926260-61-9

4-(1-Aminoethyl)-N,N-dimethylbenzenesulfonamide

Description:

4-(1-Aminoethyl)-N,N-dimethylbenzenesulfonamide, identified by its CAS number 926260-61-9, is a sulfonamide compound characterized by the presence of a sulfonamide functional group (-SO2NH2) attached to a dimethylated aniline structure. This compound features an aminoethyl side chain, which contributes to its potential biological activity. Typically, sulfonamides are known for their antibacterial properties, and modifications to their structure can influence their pharmacological effects. The presence of the dimethyl groups enhances lipophilicity, potentially affecting the compound's solubility and permeability. Additionally, the aminoethyl group may participate in hydrogen bonding, which can be crucial for interactions with biological targets. The compound's molecular structure suggests it may exhibit a range of chemical reactivities, including the ability to form salts or undergo substitution reactions. Overall, 4-(1-Aminoethyl)-N,N-dimethylbenzenesulfonamide represents a class of compounds that may have applications in medicinal chemistry, particularly in the development of therapeutic agents.

Formula: C₁₀H₁₆N₂O₂S

InChI: InChI=1S/C10H16N2O2S/c1-8(11)9-4-6-10(7-5-9)15(13,14)12(2)3/h4-8H,11H2,1-3H3

InChI key: InChIKey=WCMBYFGFGNENKB-UHFFFAOYSA-N

SMILES: S(N(C)C)(=O)(=O)C1=CC=C(C(C)N)C=C1

Synonyms:

• Benzenesulfonamide, 4-(1-aminoethyl)-N,N-dimethyl-
• 4-(1-Aminoethyl)-N,N-dimethylbenzenesulfonamide