CymitQuimica logo

CAS 926263-13-0

:

4-amino-N,3-dimethylbenzamide

Description:
4-Amino-N,3-dimethylbenzamide is an organic compound characterized by its amide functional group and a substituted aromatic ring. The presence of an amino group (-NH2) at the para position and two methyl groups at the meta position of the benzene ring contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the ability of the amine to engage in hydrogen bonding. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the synthesis of biologically active compounds. The presence of both amino and amide functionalities may also influence its reactivity, making it a candidate for various chemical reactions, including acylation and substitution. Additionally, the compound's stability and reactivity can be affected by the steric hindrance introduced by the methyl groups, which may influence its interaction with other molecules. Overall, 4-amino-N,3-dimethylbenzamide is a versatile compound with potential applications in medicinal chemistry and organic synthesis.
Formula:C9H12N2O
InChI:InChI=1/C9H12N2O/c1-6-5-7(9(12)11-2)3-4-8(6)10/h3-5H,10H2,1-2H3,(H,11,12)
InChI key:NXJKKMUCCPHXMG-UHFFFAOYSA-N
SMILES:Cc1cc(ccc1N)C(=O)NC
Found 2 products.