CAS 926265-19-2
:5-Amino-2-chloro-N-(1-methylethyl)benzamide
Description:
5-Amino-2-chloro-N-(1-methylethyl)benzamide is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with an amino group, a chloro group, and an isopropyl amide. The presence of the amino group (-NH2) indicates that it can participate in hydrogen bonding, potentially enhancing its solubility in polar solvents. The chloro substituent introduces a halogen, which can influence the compound's reactivity and polarity. The isopropyl group contributes to the steric bulk around the amide nitrogen, potentially affecting the compound's biological activity and interactions with other molecules. This compound may exhibit properties typical of amides, such as moderate to high melting and boiling points compared to other organic compounds of similar molecular weight. Its specific applications and biological activity would depend on its interaction with biological systems, making it of interest in pharmaceutical research and development. As with many organic compounds, safety data and handling precautions should be considered due to potential toxicity or reactivity.
Formula:C10H13ClN2O
InChI:InChI=1S/C10H13ClN2O/c1-6(2)13-10(14)8-5-7(12)3-4-9(8)11/h3-6H,12H2,1-2H3,(H,13,14)
InChI key:InChIKey=UHILNFUOROREHQ-UHFFFAOYSA-N
SMILES:C(NC(C)C)(=O)C1=C(Cl)C=CC(N)=C1
Synonyms:- 5-Amino-2-chloro-N-(1-methylethyl)benzamide
- Benzamide, 5-amino-2-chloro-N-(1-methylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
