CAS 926265-38-5
:N-(3-amino-4-chlorophenyl)-2-methoxyacetamide
Description:
N-(3-amino-4-chlorophenyl)-2-methoxyacetamide, with the CAS number 926265-38-5, is a chemical compound characterized by its specific functional groups and structural features. It contains an amine group (-NH2), a chloro-substituted aromatic ring, and an acetamide moiety, which contribute to its potential biological activity. The presence of the methoxy group (-OCH3) enhances its solubility and may influence its interaction with biological targets. This compound is typically a solid at room temperature and may exhibit moderate stability under standard conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various diseases. The chlorophenyl group may impart specific electronic properties, affecting the compound's reactivity and binding affinity to biological molecules. As with many organic compounds, safety and handling precautions should be observed, as the biological effects and toxicity profiles would need to be evaluated in a laboratory setting.
Formula:C9H11ClN2O2
InChI:InChI=1/C9H11ClN2O2/c1-14-5-9(13)12-6-2-3-7(10)8(11)4-6/h2-4H,5,11H2,1H3,(H,12,13)
SMILES:COCC(=Nc1ccc(c(c1)N)Cl)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
