CAS 926265-87-4
:2-(4-aminophenyl)-1-(pyrrolidin-1-yl)ethanone
Description:
2-(4-Aminophenyl)-1-(pyrrolidin-1-yl)ethanone, also known by its CAS number 926265-87-4, is a chemical compound characterized by its unique structure, which includes an ethanone moiety linked to a pyrrolidine ring and an amino-substituted phenyl group. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar organic solvents due to the presence of both amine and carbonyl functional groups. Its molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding, which can influence its reactivity and interactions with biological systems. The presence of the amino group may also impart basicity, allowing it to engage in acid-base chemistry. Additionally, compounds of this type may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to their potential biological activity. However, specific safety and handling guidelines should be followed, as with all chemical substances, to mitigate any risks associated with their use.
Formula:C12H16N2O
InChI:InChI=1/C12H16N2O/c13-11-5-3-10(4-6-11)9-12(15)14-7-1-2-8-14/h3-6H,1-2,7-9,13H2
SMILES:C1CCN(C1)C(=O)Cc1ccc(cc1)N
Synonyms:- Ethanone, 2-(4-Aminophenyl)-1-(1-Pyrrolidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.