CAS 926269-52-5

2-Fluoro-4-[(methylsulfonyl)amino]benzenesulfonyl chloride

Description:

2-Fluoro-4-[(methylsulfonyl)amino]benzenesulfonyl chloride is a chemical compound characterized by its sulfonamide and sulfonyl chloride functional groups, which contribute to its reactivity and potential applications in organic synthesis. The presence of a fluorine atom on the aromatic ring enhances its electrophilic properties, making it useful in various chemical reactions, including nucleophilic substitutions. The methylsulfonyl group provides additional solubility and stability, while the sulfonyl chloride moiety is a versatile intermediate in the synthesis of other compounds, particularly in the preparation of sulfonamides and other sulfonyl derivatives. This compound is typically handled with care due to its potential reactivity and the presence of chlorine, which can release harmful gases upon hydrolysis. It is primarily utilized in pharmaceutical research and development, particularly in the synthesis of biologically active molecules. As with many sulfonyl chlorides, it is important to consider its storage and handling requirements to prevent degradation and ensure safety in laboratory environments.

Formula: C₇H₇ClFNO₄S₂

InChI: InChI=1S/C7H7ClFNO4S2/c1-15(11,12)10-5-2-3-7(6(9)4-5)16(8,13)14/h2-4,10H,1H3

InChI key: InChIKey=PPMAWRKBXMPDHY-UHFFFAOYSA-N

SMILES: N(S(C)(=O)=O)C1=CC(F)=C(S(Cl)(=O)=O)C=C1

Synonyms:

• Benzenesulfonyl chloride, 2-fluoro-4-[(methylsulfonyl)amino]-
• 2-Fluoro-4-[(methylsulfonyl)amino]benzenesulfonyl chloride

2-Fluoro-4-methanesulfonamidobenzene-1-sulfonyl chloride

CAS: 926269-52-5

Versatile small molecule scaffold

Formula: C₇H₇ClFNO₄S₂

Purity: Min. 95%

Molecular weight: 287.7 g/mol

Ref: 3D-BMB26952