CAS 926270-06-6
:N-(3-amino-4-fluorophenyl)methanesulfonamide
Description:
N-(3-amino-4-fluorophenyl)methanesulfonamide is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. This compound features a fluorinated aromatic ring, specifically a 4-fluoro substitution on a phenyl group, which can influence its biological activity and solubility. The presence of an amino group at the meta position enhances its potential for hydrogen bonding and reactivity. The methanesulfonamide moiety contributes to its polar characteristics, making it soluble in polar solvents. This compound may exhibit various pharmacological properties, potentially acting as an inhibitor or modulator in biological systems. Its structure suggests that it could interact with specific enzymes or receptors, making it of interest in medicinal chemistry. Additionally, the fluorine atom can enhance metabolic stability and alter lipophilicity, impacting the compound's pharmacokinetics. Overall, N-(3-amino-4-fluorophenyl)methanesulfonamide is a compound of interest in drug development and research due to its unique structural features and potential therapeutic applications.
Formula:C7H9FN2O2S
InChI:InChI=1/C7H9FN2O2S/c1-13(11,12)10-5-2-3-6(8)7(9)4-5/h2-4,10H,9H2,1H3
SMILES:CS(=O)(=O)Nc1ccc(c(c1)N)F
Synonyms:- methanesulfonamide, N-(3-amino-4-fluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
