CAS 926270-89-5

N2-[(3,4-Difluorophenyl)methyl]-N1,N1-dimethyl-1,2-ethanediamine

Description:

N2-[(3,4-Difluorophenyl)methyl]-N1,N1-dimethyl-1,2-ethanediamine, with the CAS number 926270-89-5, is a chemical compound characterized by its unique structure, which includes a difluorophenyl group and a dimethylated ethanediamine backbone. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility and reactivity. The presence of fluorine atoms in the phenyl ring can enhance lipophilicity and potentially affect the compound's biological activity. It may be utilized in various applications, including medicinal chemistry, where its structural features could contribute to the development of pharmaceuticals. The compound's stability, reactivity, and interaction with biological systems would depend on its specific molecular interactions and the environment in which it is used. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of fluorine, which can impart unique toxicological properties.

Formula: C₁₁H₁₆F₂N₂

InChI: InChI=1S/C11H16F2N2/c1-15(2)6-5-14-8-9-3-4-10(12)11(13)7-9/h3-4,7,14H,5-6,8H2,1-2H3

InChI key: InChIKey=BJWXDXKVROFRQK-UHFFFAOYSA-N

SMILES: C(NCCN(C)C)C1=CC(F)=C(F)C=C1

Synonyms:

• 1,2-Ethanediamine, N2-[(3,4-difluorophenyl)methyl]-N1,N1-dimethyl-
• N2-[(3,4-Difluorophenyl)methyl]-N1,N1-dimethyl-1,2-ethanediamine

[(3,4-Difluorophenyl)methyl][2-(dimethylamino)ethyl]amine

CAS: 926270-89-5

Versatile small molecule scaffold

Formula: C₁₁H₁₆F₂N₂

Purity: Min. 95%

Molecular weight: 214.25 g/mol

Ref: 3D-BMB27089