
CAS 926272-61-9
:N-(4-Amino-2-methylphenyl)tetrahydro-2-furancarboxamide
Description:
N-(4-Amino-2-methylphenyl)tetrahydro-2-furancarboxamide, identified by its CAS number 926272-61-9, is a chemical compound characterized by its unique structural features. It contains a tetrahydrofuran ring, which contributes to its cyclic nature, and an amide functional group that enhances its potential for hydrogen bonding. The presence of the 4-amino-2-methylphenyl moiety indicates that it has both amino and aromatic characteristics, which can influence its reactivity and solubility. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential interactions with biological targets, possibly leading to applications in drug development. Additionally, the presence of both hydrophilic (amide) and hydrophobic (aromatic) components may affect its pharmacokinetic properties, such as absorption and distribution in biological systems. Overall, N-(4-Amino-2-methylphenyl)tetrahydro-2-furancarboxamide represents a complex molecule with potential utility in various chemical and biological applications.
Formula:C12H16N2O2
InChI:InChI=1S/C12H16N2O2/c1-8-7-9(13)4-5-10(8)14-12(15)11-3-2-6-16-11/h4-5,7,11H,2-3,6,13H2,1H3,(H,14,15)
InChI key:InChIKey=XCIVEGSOWIWKCU-UHFFFAOYSA-N
SMILES:N(C(=O)C1CCCO1)C2=C(C)C=C(N)C=C2
Synonyms:- N-(4-Amino-2-methylphenyl)tetrahydro-2-furancarboxamide
- 2-Furancarboxamide, N-(4-amino-2-methylphenyl)tetrahydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.