CymitQuimica logo

CAS 926291-64-7

:

Carbamic acid, N-[(1R)-1-(3-chlorophenyl)-2-hydroxyethyl]-, 1,1-dimethylethyl ester

Description:
Carbamic acid, N-[(1R)-1-(3-chlorophenyl)-2-hydroxyethyl]-, 1,1-dimethylethyl ester, identified by CAS number 926291-64-7, is an organic compound that features a carbamate functional group. This substance is characterized by its ester linkage, which is formed between a carbamic acid and an alcohol, in this case, 1,1-dimethylethanol. The presence of a 3-chlorophenyl group and a hydroxyethyl moiety contributes to its unique chemical properties, including potential biological activity. The chirality at the carbon center indicates that the compound exists in a specific stereoisomeric form, which can influence its reactivity and interactions in biological systems. Typically, carbamates are known for their applications in pharmaceuticals and agrochemicals, often serving as intermediates or active ingredients. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. Overall, this compound exemplifies the complexity and utility of carbamate derivatives in chemical synthesis and application.
Formula:C13H18ClNO3
InChI:InChI=1S/C13H18ClNO3/c1-13(2,3)18-12(17)15-11(8-16)9-5-4-6-10(14)7-9/h4-7,11,16H,8H2,1-3H3,(H,15,17)/t11-/m0/s1
InChI key:SWYMATJMMKRYJJ-NSHDSACASA-N
SMILES:CC(C)(C)OC(=O)N[C@@H](CO)C1=CC(=CC=C1)Cl
Found 4 products.