CAS 926319-54-2
:N-[2-(4-Methoxyphenyl)-1,1-dimethylethyl]acetamide
Description:
N-[2-(4-Methoxyphenyl)-1,1-dimethylethyl]acetamide, identified by its CAS number 926319-54-2, is an organic compound characterized by its amide functional group. This substance features a bulky tert-butyl group attached to a phenyl ring that is further substituted with a methoxy group, contributing to its unique steric and electronic properties. The presence of the methoxy group enhances the compound's lipophilicity, potentially influencing its solubility and biological activity. As an amide, it may exhibit hydrogen bonding capabilities, which can affect its interactions in biological systems. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to modulate biological targets. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its stability and reactivity can be influenced by the surrounding functional groups. Overall, N-[2-(4-Methoxyphenyl)-1,1-dimethylethyl]acetamide represents a class of compounds that may have significant implications in drug design and development.
Formula:C13H19NO2
InChI:InChI=1S/C13H19NO2/c1-10(15)14-13(2,3)9-11-5-7-12(16-4)8-6-11/h5-8H,9H2,1-4H3,(H,14,15)
InChI key:InChIKey=DDQHQQRZYRDMQX-UHFFFAOYSA-N
SMILES:C(C(NC(C)=O)(C)C)C1=CC=C(OC)C=C1
Synonyms:- N-[2-(4-Methoxyphenyl)-1,1-dimethylethyl]acetamide
- Acetamide, N-[2-(4-methoxyphenyl)-1,1-dimethylethyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
