CAS 92636-36-7
:1-(4-Iodophenyl)pyrrole
Description:
1-(4-Iodophenyl)pyrrole is an organic compound characterized by its pyrrole ring, which is a five-membered aromatic heterocycle containing one nitrogen atom. The presence of the 4-iodophenyl group indicates that an iodine atom is substituted at the para position of a phenyl ring attached to the pyrrole. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and reactivity due to the electron-rich nature of the pyrrole nitrogen. It may display interesting electronic and optical properties, making it of interest in various applications, including organic electronics and materials science. Additionally, the iodine substituent can influence the compound's reactivity, potentially participating in electrophilic substitution reactions or serving as a leaving group in nucleophilic reactions. The compound's solubility, melting point, and other physical properties can vary based on its molecular structure and the presence of functional groups. Overall, 1-(4-Iodophenyl)pyrrole is a versatile compound with potential applications in synthetic chemistry and materials development.
Formula:C10H8IN
InChI:InChI=1/C10H8IN/c11-9-3-5-10(6-4-9)12-7-1-2-8-12/h1-8H
SMILES:c1ccn(c1)c1ccc(cc1)I
Synonyms:- 1-(4-iodophenyl)-1H-pyrrole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-(4-Iodophenyl)pyrrole, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C10H8INPurity:97%Color and Shape:Cream to brown, PowderMolecular weight:269.091-(4-Iodophenyl)-1H-pyrrole
CAS:<p>1-(4-Iodophenyl)-1H-pyrrole</p>Purity:99%Molecular weight:269.08g/mol



