CAS 92658-75-8
:9-(tetrahydrofuran-2-yl)-3,9-dihydro-6H-purin-6-one
Description:
9-(Tetrahydrofuran-2-yl)-3,9-dihydro-6H-purin-6-one, with the CAS number 92658-75-8, is a purine derivative characterized by its unique structural features that include a purine ring system fused with a tetrahydrofuran moiety. This compound typically exhibits properties associated with purines, such as potential biological activity, particularly in relation to nucleic acid metabolism and signaling pathways. Its molecular structure suggests it may participate in hydrogen bonding and exhibit solubility in polar solvents, which is common for compounds containing heteroatoms like nitrogen and oxygen. The presence of the tetrahydrofuran ring may also influence its conformational flexibility and reactivity. As a purine analog, it could be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological processes. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical measurement or detailed literature references for precise characterization.
Formula:C9H10N4O2
InChI:InChI=1/C9H10N4O2/c14-9-7-8(10-4-11-9)13(5-12-7)6-2-1-3-15-6/h4-6H,1-3H2,(H,10,11,14)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.