CAS 92658-77-0

1-[1-(5-methylisoxazol-3-yl)-1H-1,2,4-triazol-3-yl]acetone

Description:

1-[1-(5-methylisoxazol-3-yl)-1H-1,2,4-triazol-3-yl]acetone, with the CAS number 92658-77-0, is a chemical compound characterized by its complex structure, which includes a triazole and isoxazole moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the isoxazole ring suggests possible applications in medicinal chemistry, particularly in the development of antifungal or antibacterial agents. The triazole component is known for its role in various biological activities, including acting as a scaffold for drug design. Additionally, the acetone group may influence the compound's reactivity and interaction with biological targets. Overall, this compound's unique structural features contribute to its potential utility in various chemical and biological applications, warranting further investigation into its properties and effects.

Formula: C₉H₁₀N₄O₂

InChI: InChI=1/C9H10N4O2/c1-6(14)3-8-10-5-13(11-8)9-4-7(2)15-12-9/h4-5H,3H2,1-2H3

SMILES: CC(=O)Cc1ncn(c2cc(C)on2)n1

Synonyms:

• 1-[1-(5-methyl-1,2-oxazol-3-yl)-1H-1,2,4-triazol-3-yl]propan-2-one

1-[1-(5-Methylisoxazol-3-yl)-1H-1,2,4-triazol-3-yl]acetone

CAS: 92658-77-0

1-[1-(5-Methylisoxazol-3-yl)-1H-1,2,4-triazol-3-yl]acetone

Purity: ≥95%

Molecular weight: 206.20g/mol

Ref: 54-OR23849

1-[1-(5-methylisoxazol-3-yl)-1H-1,2,4-triazol-3-yl]acetone

CAS: 92658-77-0

Color and Shape: Liquid

Molecular weight: 206.2050018310547

Ref: 10-F518901