CAS 926657-23-0
:(1S)-1-(4-fluorophenyl)-3-iodo-propan-1-ol
Description:
(1S)-1-(4-fluorophenyl)-3-iodo-propan-1-ol, with the CAS number 926657-23-0, is an organic compound characterized by its specific stereochemistry and functional groups. It features a propanol backbone, which includes a hydroxyl (-OH) group, making it an alcohol. The presence of a 4-fluorophenyl group indicates that a fluorine atom is substituted on a phenyl ring at the para position, contributing to the compound's unique electronic properties and potential reactivity. Additionally, the iodine atom attached to the third carbon of the propanol chain enhances its reactivity, particularly in nucleophilic substitution reactions. This compound may exhibit interesting biological activity due to its structural features, making it a candidate for further research in medicinal chemistry. Its stereochemistry, denoted by the (1S) configuration, suggests specific spatial arrangements that can influence its interactions with biological targets. Overall, this compound's characteristics make it a subject of interest in both synthetic and medicinal chemistry contexts.
Formula:C9H10FIO
InChI:InChI=1/C9H10FIO/c10-8-3-1-7(2-4-8)9(12)5-6-11/h1-4,9,12H,5-6H2/t9-/m0/s1
SMILES:c1cc(ccc1[C@H](CCI)O)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
