CymitQuimica logo

CAS 92669-55-1

:

1,4,7,10-Tetraoxa-13-azacyclopentadecane-13-acetic acid, ethyl ester

Description:
1,4,7,10-Tetraoxa-13-azacyclopentadecane-13-acetic acid, ethyl ester, commonly referred to by its CAS number 92669-55-1, is a complex organic compound characterized by its unique cyclic structure that incorporates both nitrogen and oxygen atoms. This compound features a 15-membered ring containing four ether (–O–) linkages and one nitrogen atom, contributing to its chelating properties, which can be significant in coordination chemistry. The presence of the acetic acid moiety and ethyl ester functional group enhances its solubility in organic solvents and may influence its reactivity and interaction with biological systems. The compound is likely to exhibit properties such as moderate polarity and potential biological activity, making it of interest in fields like medicinal chemistry and materials science. Its structural features suggest potential applications in drug delivery systems or as a ligand in metal ion coordination. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical measurement or detailed literature references for precise characterization.
Formula:C14H27NO6
InChI:InChI=1S/C14H27NO6/c1-2-21-14(16)13-15-3-5-17-7-9-19-11-12-20-10-8-18-6-4-15/h2-13H2,1H3
InChI key:InChIKey=KCYCTCVCUHQJKU-UHFFFAOYSA-N
SMILES:C(C(OCC)=O)N1CCOCCOCCOCCOCC1
Synonyms:
  • Ethyl 1,4,7,10-tetraoxa-13-azacyclopentadecane-13-acetate
  • 1,4,7,10-Tetraoxa-13-azacyclopentadecane-13-acetic acid, ethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.