CAS 92676-86-3
:trans-Cefprozil
Description:
Trans-Cefprozil is a semisynthetic cephalosporin antibiotic, primarily used to treat bacterial infections. It exhibits a broad spectrum of activity against various Gram-positive and Gram-negative bacteria. The chemical structure of trans-Cefprozil features a beta-lactam ring, which is essential for its antibacterial properties, allowing it to inhibit bacterial cell wall synthesis. This compound is characterized by its stability against certain beta-lactamases, making it effective against resistant strains. Trans-Cefprozil is typically administered orally and is well-absorbed in the gastrointestinal tract. Its pharmacokinetics include a relatively long half-life, allowing for less frequent dosing. Common side effects may include gastrointestinal disturbances, allergic reactions, and, in rare cases, more severe hypersensitivity reactions. As with other antibiotics, it is crucial to use trans-Cefprozil judiciously to minimize the risk of developing antibiotic resistance. Overall, trans-Cefprozil is a valuable therapeutic agent in the management of various infections, particularly in patients who may be allergic to penicillin.
Formula:C18H19N3O5S
InChI:InChI=1S/C18H19N3O5S/c1-2-3-10-8-27-17-13(16(24)21(17)14(10)18(25)26)20-15(23)12(19)9-4-6-11(22)7-5-9/h2-7,12-13,17,22H,8,19H2,1H3,(H,20,23)(H,25,26)/b3-2+/t12-,13-,17-/m1/s1
InChI key:InChIKey=WDLWHQDACQUCJR-ZAMMOSSLSA-N
SMILES:C(O)(=O)C=1N2[C@@]([C@H](NC([C@H](N)C3=CC=C(O)C=C3)=O)C2=O)(SCC1/C=C/C)[H]
Synonyms:- 5-Thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid, 7-[[(2R)-amino(4-hydroxyphenyl)acetyl]amino]-8-oxo-3-(1E)-1-propenyl-, (6R,7R)-
- BMY 28167
- (6R,7R)-7-[[(2R)-2-Amino-2-(4-hydroxyphenyl)acetyl]amino]-8-oxo-3-(1E)-1-propen-1-yl-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid
- 5-Thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid, 7-[[(2R)-2-amino-2-(4-hydroxyphenyl)acetyl]amino]-8-oxo-3-(1E)-1-propen-1-yl-, (6R,7R)-
- 5-Thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid, 7-[[amino(4-hydroxyphenyl)acetyl]amino]-8-oxo-3-(1-propenyl)-, [6R-[3(E),6α,7β(R*)]]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Cefprozil (E)-isomer
CAS:<p>Cefprozil (E)-isomer is an anticancer agent that has been shown to exhibit potent tumor inhibitory activity. It is an inhibitor of cancer cell growth and proliferation, inducing apoptosis and cell cycle arrest in various human cancer cell lines. Cefprozil (E)-isomer has been found to be effective against a range of cancers, including leukemia and tumors of the urinary system. This compound has been extensively used in traditional Chinese medicine as an anti-cancer agent due to its ability to inhibit protein synthesis in cancer cells. Its mechanism of action involves the inhibition of tumor angiogenesis, which deprives the tumor cells of nutrients required for their growth and survival. Cefprozil (E)-isomer may be a promising candidate for the development of novel anticancer therapies.</p>Formula:C18H19N3O5SPurity:Min. 95%Molecular weight:389.43 g/mol

