CAS 926908-04-5

N-hydroxy-7-(naphthalen-2-ylsulfanyl)heptanamide

Description:

N-hydroxy-7-(naphthalen-2-ylsulfanyl)heptanamide is a chemical compound characterized by its unique structure, which includes a naphthalene moiety linked to a heptanamide chain. The presence of the N-hydroxy group indicates that it has a hydroxyl functional group attached to the nitrogen atom of the amide, which can influence its reactivity and solubility. The naphthalenylsulfanyl group suggests that the compound may exhibit interesting electronic properties due to the aromatic nature of naphthalene, potentially affecting its interactions in biological systems. This compound may be of interest in medicinal chemistry, particularly for its potential applications in drug development or as a biochemical probe. Its specific properties, such as solubility, melting point, and stability, would depend on the overall molecular structure and the presence of functional groups. As with many organic compounds, understanding its behavior in various solvents and under different conditions is crucial for its application in research and industry.

Formula: C₁₇H₂₁NO₂S

InChI: InChI=1/C17H21NO2S/c19-17(18-20)9-3-1-2-6-12-21-16-11-10-14-7-4-5-8-15(14)13-16/h4-5,7-8,10-11,13,20H,1-3,6,9,12H2,(H,18,19)

SMILES: C(CCCSc1ccc2ccccc2c1)CCC(=NO)O

Synonyms:

• N-hydroxy-7-(2-naphthylthio)heptanamide

N-hydroxy-7-(2-naphthalenylthio)-Heptanamide

CAS: 926908-04-5

Formula: C₁₇H₂₁NO₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 303.4191

Ref: IN-DA0036Q8

HNHA

CAS: 926908-04-5

HNHA

Purity: ≥95%

Molecular weight: 303.42g/mol

Ref: 54-BUP07254

HNHA

CAS: 926908-04-5

HNHA is an inhibitor of HDAC.

Formula: C₁₇H₂₁NO₂S

Purity: 98.04%

Color and Shape: Solid

Molecular weight: 303.42

Ref: TM-T21806