CymitQuimica logo

CAS 926921-60-0

:

3-Methyl-2-furansulfonyl chloride

Description:
3-Methyl-2-furansulfonyl chloride is an organic compound characterized by the presence of a furan ring, a sulfonyl chloride functional group, and a methyl substituent. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its reactivity, particularly due to the sulfonyl chloride group, which can participate in nucleophilic substitution reactions, making it useful in organic synthesis for the introduction of sulfonyl groups into various substrates. The furan ring contributes to its aromatic properties, enhancing its stability and reactivity in certain chemical environments. 3-Methyl-2-furansulfonyl chloride is generally handled with caution due to its potential to release hydrochloric acid upon hydrolysis, and it may pose health risks if inhaled or if it comes into contact with skin. Proper safety measures, including the use of personal protective equipment and working in a well-ventilated area, are essential when working with this compound.
Formula:C5H5ClO3S
InChI:InChI=1S/C5H5ClO3S/c1-4-2-3-9-5(4)10(6,7)8/h2-3H,1H3
InChI key:InChIKey=XCKGHPXWCMNKHV-UHFFFAOYSA-N
SMILES:S(Cl)(=O)(=O)C1=C(C)C=CO1
Synonyms:
  • 3-Methyl-2-furansulfonyl chloride
  • 2-Furansulfonyl chloride, 3-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.