CAS 926921-64-4

2,3,4,5,6-Pentafluorophenyl 1-methyl-1H-pyrazole-5-carboxylate

Description:

2,3,4,5,6-Pentafluorophenyl 1-methyl-1H-pyrazole-5-carboxylate is a chemical compound characterized by its complex structure, which includes a pyrazole ring and a pentafluorophenyl group. The presence of five fluorine atoms on the phenyl ring significantly enhances its electronegativity and lipophilicity, making it a highly reactive and potentially useful compound in various chemical applications. The pyrazole moiety contributes to its biological activity, often making it a candidate for pharmaceutical research. This compound is typically synthesized through specific organic reactions that involve the introduction of the pentafluorophenyl group and the carboxylate functionality. Its properties may include high thermal stability and solubility in organic solvents, which are advantageous for its use in synthetic chemistry and material science. Additionally, due to the presence of fluorine atoms, it may exhibit unique electronic properties, making it of interest in the development of agrochemicals or advanced materials. Safety data should be consulted for handling, as fluorinated compounds can pose specific health and environmental risks.

Formula: C₁₁H₅F₅N₂O₂

InChI: InChI=1S/C11H5F5N2O2/c1-18-4(2-3-17-18)11(19)20-10-8(15)6(13)5(12)7(14)9(10)16/h2-3H,1H3

InChI key: InChIKey=LFLXSDHHZKOTLP-UHFFFAOYSA-N

SMILES: O(C(=O)C=1N(C)N=CC1)C2=C(F)C(F)=C(F)C(F)=C2F

Synonyms:

• 2,3,4,5,6-Pentafluorophenyl 1-methyl-1H-pyrazole-5-carboxylate
• 1H-Pyrazole-5-carboxylic acid, 1-methyl-, 2,3,4,5,6-pentafluorophenyl ester

Pentafluorophenyl 1-methyl-1H-pyrazole-5-carboxylate

Controlled Product

CAS: 926921-64-4

Please enquire for more information about Pentafluorophenyl 1-methyl-1H-pyrazole-5-carboxylate including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₁H₅F₅N₂O₂

Purity: Min. 95%

Molecular weight: 292.16 g/mol

Ref: 3D-BMB92164