CAS 926921-71-3

1-(4-bromo-1-methyl-1H-pyrazol-3-yl)methanamine

Description:

1-(4-bromo-1-methyl-1H-pyrazol-3-yl)methanamine, identified by its CAS number 926921-71-3, is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic ring containing two nitrogen atoms. The presence of a bromine atom at the para position of the pyrazole ring contributes to its reactivity and potential applications in medicinal chemistry. The methanamine group attached to the pyrazole ring enhances its basicity and can participate in various chemical reactions, including nucleophilic substitutions. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Its solubility, stability, and reactivity can vary depending on the solvent and conditions used, which are important factors to consider in practical applications. Overall, the unique structural features of this compound suggest potential utility in various chemical and biological contexts.

Formula: C₅H₈BrN₃

InChI: InChI=1/C5H8BrN3/c1-9-3-4(6)5(2-7)8-9/h3H,2,7H2,1H3

SMILES: Cn1cc(c(CN)n1)Br

(4-Bromo-1-methyl-1H-pyrazol-3-yl)methylamine

CAS: 926921-71-3

Formula: C₅H₈BrN₃

Purity: 95%

Molecular weight: 190.0411

Ref: IN-DA006ERF

3-(Aminomethyl)-4-bromo-1-methyl-1H-pyrazole

CAS: 926921-71-3

3-(Aminomethyl)-4-bromo-1-methyl-1H-pyrazole

Formula: C₅H₈BrN₃

Purity: ≥95%

Color and Shape: clear. yellow liquid

Molecular weight: 190.04g/mol

Ref: 54-OR12376

(4-bromo-1-methyl-1H-pyrazol-3-yl)methylamine

CAS: 926921-71-3

Formula: C₅H₈BrN₃

Purity: 95.0%

Color and Shape: Liquid

Molecular weight: 190.044

Ref: 10-F425734