CAS 927-67-3
:N-Propylthiourea
Description:
N-Propylthiourea is an organic compound characterized by its thiourea functional group, which consists of a carbon atom double-bonded to a sulfur atom and single-bonded to an amine group. It has the molecular formula C4H10N2S and is typically a white to off-white crystalline solid. This compound is soluble in water and organic solvents, making it versatile for various applications. N-Propylthiourea is known for its role as a reagent in organic synthesis and as a potential inhibitor in biochemical processes, particularly in studies related to enzyme activity and metabolic pathways. It exhibits properties such as being a weak base and can participate in hydrogen bonding due to the presence of nitrogen and sulfur atoms. Additionally, N-Propylthiourea has been investigated for its potential use in agriculture and pharmaceuticals, although safety and handling precautions are necessary due to its toxicological profile. Overall, its unique chemical structure and reactivity make it a valuable compound in both research and industrial applications.
Formula:C4H10N2S
InChI:InChI=1S/C4H10N2S/c1-2-3-6-4(5)7/h2-3H2,1H3,(H3,5,6,7)
InChI key:InChIKey=UHGKYJXJYJWDAM-UHFFFAOYSA-N
SMILES:N(C(N)=S)CCC
Synonyms:- 1-Propyl-2-thiourea
- 1-Propylthiourea
- Propyl-2-thiourea
- Propylthiourea
- Thiourea, N-propyl-
- Thiourea, propyl-
- Urea, 1-propyl-2-thio-
- N-Propylthiourea
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
N-(n-Propyl)thiourea, 98%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C4H10N2SPurity:98%Color and Shape:White, Crystalline powderMolecular weight:118.2Propylthiourea
CAS:<p>Please enquire for more information about Propylthiourea including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C4H10N2SPurity:Min. 95%Color and Shape:PowderMolecular weight:118.2 g/mol




