CAS 927-70-8: S-(2-Bromoethyl) ethanethioate
Description:S-(2-Bromoethyl) ethanethioate, with the CAS number 927-70-8, is an organosulfur compound characterized by the presence of a thioate functional group and a bromoethyl substituent. This compound typically appears as a colorless to pale yellow liquid and is known for its reactivity due to the presence of the bromine atom, which can participate in nucleophilic substitution reactions. The thioate group contributes to its potential applications in organic synthesis, particularly in the formation of carbon-sulfur bonds. It is soluble in organic solvents, making it useful in various chemical reactions. Safety considerations are important when handling this compound, as it may pose health risks through inhalation or skin contact. Proper storage in a cool, dry place away from incompatible substances is recommended to maintain its stability. Overall, S-(2-Bromoethyl) ethanethioate serves as a valuable intermediate in the synthesis of more complex organic molecules.
Formula:C4H7BrOS
InChI:InChI=1S/C4H7BrOS/c1-4(6)7-3-2-5/h2-3H2,1H3
InChI key:InChIKey=NYHLAZJBJZRGPV-UHFFFAOYSA-N
SMILES:O=C(SCCBr)C
- Synonyms:
- Acetic acid, thio-, S-(2-bromoethyl) ester
- Ethanethioic acid, S-(2-bromoethyl) ester
- Ethanethiol, 2-bromo-, acetate
- S-(2-Bromoethyl) ethanethioate
- 2-Bromoethyl thioacetate
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | Ethanethioic acid, s-(2-bromoethyl) ester REF: 3D-FE57847CAS: 927-70-8 | Min. 95% | - - - | Discontinued product |
Ethanethioic acid, s-(2-bromoethyl) ester
Ref: 3D-FE57847
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information |
