
CAS 92716-38-6
:1,4-Dihydro-1-propyl-2,3-pyrazinedione
Description:
1,4-Dihydro-1-propyl-2,3-pyrazinedione, with the CAS number 92716-38-6, is a chemical compound characterized by its pyrazinedione structure, which features a six-membered ring containing two nitrogen atoms and two carbonyl groups. This compound typically exhibits properties associated with diketones, including potential reactivity due to the presence of the carbonyl groups, which can participate in various chemical reactions such as nucleophilic addition and condensation. The presence of the propyl group contributes to its hydrophobic characteristics, influencing its solubility in organic solvents. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical and agricultural research. Its stability and reactivity can be affected by environmental conditions such as pH and temperature. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled. Overall, 1,4-Dihydro-1-propyl-2,3-pyrazinedione is a compound of interest in various fields, including synthetic chemistry and medicinal applications.
Formula:C7H10N2O2
InChI:InChI=1S/C7H10N2O2/c1-2-4-9-5-3-8-6(10)7(9)11/h3,5H,2,4H2,1H3,(H,8,10)
InChI key:InChIKey=YDQMPGDGAVXCFC-UHFFFAOYSA-N
SMILES:C(CC)N1C(=O)C(=O)NC=C1
Synonyms:- 2,3-Pyrazinedione, 1,4-dihydro-1-propyl-
- 1,4-Dihydro-1-propyl-2,3-pyrazinedione
- 1-Propyl-1,4-dihydro-pyrazine-2,3-dione
- 1-Propylpyrazine-2,3(1H,4H)-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.