CymitQuimica logo

CAS 92716-39-7

:

1,4-Dihydro-1-(1-methylethyl)-2,3-pyrazinedione

Description:
1,4-Dihydro-1-(1-methylethyl)-2,3-pyrazinedione, identified by its CAS number 92716-39-7, is a chemical compound characterized by its pyrazinedione structure, which features a five-membered ring containing two nitrogen atoms and two carbonyl groups. This compound typically exhibits a yellow to brown color and is soluble in organic solvents, reflecting its non-polar characteristics. It is known for its potential applications in various fields, including pharmaceuticals and agrochemicals, due to its biological activity. The presence of the isopropyl group (1-methylethyl) contributes to its hydrophobic nature, influencing its reactivity and interaction with biological systems. Additionally, the compound may participate in various chemical reactions, such as nucleophilic additions or cycloadditions, owing to the electrophilic nature of the carbonyl groups. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, 1,4-Dihydro-1-(1-methylethyl)-2,3-pyrazinedione is a notable compound with diverse potential applications in chemical research and industry.
Formula:C7H10N2O2
InChI:InChI=1S/C7H10N2O2/c1-5(2)9-4-3-8-6(10)7(9)11/h3-5H,1-2H3,(H,8,10)
InChI key:InChIKey=TXZXBDHQIUALAS-UHFFFAOYSA-N
SMILES:C(C)(C)N1C(=O)C(=O)NC=C1
Synonyms:
  • 1,4-Dihydro-1-(1-methylethyl)-2,3-pyrazinedione
  • 1-Isopropyl-1,4-dihydro-pyrazine-2,3-dione
  • 2,3-Pyrazinedione, 1,4-dihydro-1-(1-methylethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.