CAS 92717-78-7
:Silane, tetraethenyl-, homopolymer
Description:
Silane, tetraethenyl-, homopolymer, identified by CAS number 92717-78-7, is a polymer derived from the polymerization of tetraethenyl silane. This substance is characterized by its unique structure, which includes silicon atoms bonded to organic groups, specifically vinyl groups. The presence of these vinyl groups contributes to the polymer's reactivity, allowing for further cross-linking and modification, which can enhance its mechanical properties and thermal stability. Typically, this polymer exhibits good adhesion properties, making it suitable for applications in coatings, sealants, and adhesives. Additionally, it is known for its resistance to moisture and chemicals, which is advantageous in various industrial applications. The polymer's physical properties, such as flexibility and tensile strength, can vary depending on the degree of polymerization and the specific processing conditions used during its synthesis. Overall, silane, tetraethenyl-, homopolymer is valued for its versatility and performance in enhancing the durability and functionality of composite materials.
Formula:(C8H12Si)x
InChI:InChI=1S/C8H12Si/c1-5-9(6-2,7-3)8-4/h5-8H,1-4H2
InChI key:InChIKey=UFHILTCGAOPTOV-UHFFFAOYSA-N
SMILES:[Si](C=C)(C=C)(C=C)C=C
Synonyms:- Tetravinylsilane homopolymer
- Silane, tetraethenyl-, homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
