CAS 927181-98-4
:Ethyl 3-formyl-1H-indole-7-carboxylate
Description:
Ethyl 3-formyl-1H-indole-7-carboxylate is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a formyl group (-CHO) at the 3-position and an ethyl ester group at the 7-position of the indole ring, contributing to its reactivity and potential applications in organic synthesis. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents such as ethanol and dichloromethane. The presence of both the aldehyde and ester functional groups suggests that it can participate in various chemical reactions, including nucleophilic additions and condensation reactions. Ethyl 3-formyl-1H-indole-7-carboxylate may also possess biological activity, making it of interest in medicinal chemistry and drug development. Its unique structure allows for potential modifications that could enhance its properties or efficacy in specific applications. As with many organic compounds, handling should be done with care, following appropriate safety protocols.
Formula:C12H11NO3
InChI:InChI=1S/C12H11NO3/c1-2-16-12(15)10-5-3-4-9-8(7-14)6-13-11(9)10/h3-7,13H,2H2,1H3
InChI key:InChIKey=XUTDEDCNVFAAEQ-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C2C(C(C=O)=CN2)=CC=C1
Synonyms:- 1H-indole-7-carboxylic acid, 3-formyl-, ethyl ester
- Ethyl 3-formyl-1H-indole-7-carboxylate
- 3-Formylindole-7-carboxylic acid ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
