CAS 92737-01-4
:1-bromo-3,3,4,4,4-pentafluoro-2-butanone
Description:
1-Bromo-3,3,4,4,4-pentafluoro-2-butanone is a halogenated organic compound characterized by its unique structure, which includes a bromine atom and multiple fluorine substituents on a butanone backbone. This compound is notable for its high fluorine content, which imparts significant chemical stability and low reactivity, making it useful in various applications, including as a solvent or in specialty chemical synthesis. The presence of the bromine atom enhances its reactivity compared to fully fluorinated compounds, allowing for potential use in nucleophilic substitution reactions. Physically, it is typically a colorless liquid with a distinctive odor, and it is expected to have a relatively low boiling point due to its low molecular weight. Additionally, the compound is likely to be non-flammable and may pose environmental concerns due to the persistence of fluorinated compounds in the environment. Safety precautions should be taken when handling this substance, as it may be harmful if inhaled or ingested.
Formula:C4H2BrF5O
InChI:InChI=1/C4H2BrF5O/c5-1-2(11)3(6,7)4(8,9)10/h1H2
SMILES:C(C(=O)C(C(F)(F)F)(F)F)Br
Synonyms:- 1-Bromo-3,3,4,4,4-Pentafluorobutan-2-One
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1-Bromo-3,3,4,4,4-pentafluorobutan-2-one
CAS:1-Bromo-3,3,4,4,4-pentafluorobutan-2-onePurity:95%Color and Shape:Colourless LiquidMolecular weight:240.95g/mol1-Bromo-3,3,4,4,4-Pentafluoro-2-Butanone
CAS:1-Bromo-3,3,4,4,4-Pentafluoro-2-Butanone is an organofluorine compound that belongs to the group of fungicides. It is an antifungal agent that inhibits the synthesis of ergosterol in fungi and plants. 1-Bromo-3,3,4,4,4-Pentafluoro-2-Butanone has been shown to be effective against a wide range of fungi and yeasts including Candida albicans (yeast), Aspergillus niger (mould), Penicillium ochrochloron (mould), Trichoderma harzianum (fungus), Rhizopus stolonifer (fungus) and Fusarium solani (mold). This product also has a low toxicity to mammals such as humans and mice.Formula:C4H2BrF5OPurity:Min. 95%Color and Shape:PowderMolecular weight:240.95 g/mol


