CAS 92739-15-6
:(2S,5R)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid 4,4-dioxide - (6R,7R)-7-{[{[(4-ethyl-2,3-dioxopiperazin-1-yl)carbonyl]amino}(4-hydroxyphenyl)acetyl]amino}-3-{[(1-methyl-1H-tetrazol-5-yl)sulfanyl]methyl}-8-oxo-5-thia-1-azabic
Description:
The chemical substance with the name "(2S,5R)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid 4,4-dioxide - (6R,7R)-7-{[{[(4-ethyl-2,3-dioxopiperazin-1-yl)carbonyl]amino}(4-hydroxyphenyl)acetyl]amino}-3-{[(1-methyl-1H-tetrazol-5-yl)sulfanyl]methyl}-8-oxo-5-thia-1-azabic" and CAS number "92739-15-6" is a complex organic compound characterized by its bicyclic structure, which includes both thia and azabicyclic components. This substance features multiple functional groups, including carboxylic acid, amide, and sulfonyl moieties, contributing to its potential biological activity. The presence of a tetrazole ring suggests possible interactions with biological targets, making it of interest in medicinal chemistry. Its stereochemistry, indicated by the specific configurations at various chiral centers, is crucial for its pharmacological properties. The compound's unique structural features may influence its solubility, stability, and reactivity, which are essential for its application in drug development or as a biochemical probe. Overall, this compound exemplifies the complexity and diversity of modern synthetic organic chemistry, particularly in the context of developing novel therapeutic agents.
Formula:C33H38N10O13S3
InChI:InChI=1/C25H27N9O8S2.C8H11NO5S/c1-3-32-8-9-33(21(39)20(32)38)24(42)27-15(12-4-6-14(35)7-5-12)18(36)26-16-19(37)34-17(23(40)41)13(10-43-22(16)34)11-44-25-28-29-30-31(25)2;1-8(2)6(7(11)12)9-4(10)3-5(9)15(8,13)14/h4-7,15-16,22,35H,3,8-11H2,1-2H3,(H,26,36)(H,27,42)(H,40,41);5-6H,3H2,1-2H3,(H,11,12)/t15?,16-,22-;5-,6+/m11/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Cefoperasone mixture with sulbactam
CAS:Cefoperasone mixture with sulbactam is a bioactive chemical.Formula:C33H38N10O13S3Color and Shape:SolidMolecular weight:878.91
