CymitQuimica logo

CAS 927390-66-7

:

1-[3-(Methylamino)-1-azetidinyl]ethanone

Description:
1-[3-(Methylamino)-1-azetidinyl]ethanone, identified by its CAS number 927390-66-7, is a chemical compound characterized by its unique structural features. It contains an azetidine ring, which is a four-membered saturated heterocyclic structure, and a methylamino group, contributing to its potential biological activity. The presence of the ethanone functional group indicates that it is a ketone, which can influence its reactivity and interactions with other molecules. This compound may exhibit properties typical of amines and ketones, such as basicity and the ability to participate in nucleophilic reactions. Its specific characteristics, including solubility, melting point, and stability, would depend on the molecular interactions and the environment in which it is studied. Compounds like this are often of interest in medicinal chemistry and pharmacology due to their potential applications in drug development. However, detailed studies would be necessary to fully understand its properties and potential uses.
Formula:C6H12N2O
InChI:InChI=1S/C6H12N2O/c1-5(9)8-3-6(4-8)7-2/h6-7H,3-4H2,1-2H3
InChI key:InChIKey=ZGBRXGKUSFKIKS-UHFFFAOYSA-N
SMILES:C(C)(=O)N1CC(NC)C1
Synonyms:
  • 1-Acetyl-N-methylazetidin-3-amine
  • 1-[3-(Methylamino)-1-azetidinyl]ethanone
  • Ethanone, 1-[3-(methylamino)-1-azetidinyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.