CAS 927391-09-1

2-methoxy-4-(tributylstannanyl)-1,3-thiazole

Description:

2-Methoxy-4-(tributylstannanyl)-1,3-thiazole is an organotin compound characterized by the presence of a thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. The compound features a methoxy group (-OCH3) at the 2-position and a tributylstannyl group (a tin atom bonded to three butyl groups) at the 4-position of the thiazole ring. This structure imparts unique chemical properties, including potential reactivity due to the tin atom, which can participate in various chemical reactions, such as nucleophilic substitutions. The presence of the methoxy group enhances solubility in organic solvents and may influence the compound's biological activity. Organotin compounds are often studied for their applications in materials science, catalysis, and as biocides, although they can also pose environmental and health risks. The specific characteristics, such as melting point, boiling point, and solubility, would depend on the compound's molecular interactions and should be referenced from reliable chemical databases or literature for precise values.

Formula: C₁₆H₃₁NOSSn

InChI: InChI=1/C4H4NOS.3C4H9.Sn/c1-6-4-5-2-3-7-4;3*1-3-4-2;/h3H,1H3;3*1,3-4H2,2H3;/rC16H31NOSSn/c1-5-8-11-20(12-9-6-2,13-10-7-3)15-14-19-16(17-15)18-4/h14H,5-13H2,1-4H3

SMILES: CCCC[Sn](CCCC)(CCCC)c1csc(n1)OC

Synonyms:

• 2-Methoxy-4-(tributylstannyl)-1,3-thiazole
• Thiazole, 2-methoxy-4-(tributylstannyl)-

2-Methoxy-4-(tributylstannyl)-1,3-thiazole

CAS: 927391-09-1

2-Methoxy-4-(tributylstannyl)-1,3-thiazole

Purity: ≥95%

Color and Shape: Yellow Liquid

Molecular weight: 404.20g/mol

Ref: 54-OR15540

2-Methoxy-4-(tributylstannyl)-1,3-thiazole

Controlled Product

CAS: 927391-09-1

2-Methoxy-4-(tributylstannyl)-1,3-thiazole is a radical analog that inhibits the proliferation of cells. It binds to epothilones and prevents their binding to microtubuli, thereby preventing depolymerisation. This compound has been shown to inhibit proliferative diseases by inhibiting the growth of cells in culture.

Formula: C₁₆H₃₁NOSSn

Purity: Min. 95%

Molecular weight: 404.2 g/mol

Ref: 3D-CMB39109