CAS 92751-19-4
:4-Methyl-2-oxopentanoic-1-13C acid
Description:
4-Methyl-2-oxopentanoic-1-13C acid, with the CAS number 92751-19-4, is a stable organic compound characterized by its ketone and carboxylic acid functional groups. This compound features a five-carbon backbone with a methyl group and a carbonyl group, contributing to its unique reactivity and properties. The presence of the 13C isotope indicates that one of the carbon atoms in the molecule is a stable isotope of carbon, which can be useful in various applications, including tracer studies in metabolic research. The compound is likely to be a colorless liquid or solid at room temperature, exhibiting moderate solubility in polar solvents due to the carboxylic acid group. Its chemical behavior is influenced by the functional groups present, making it a potential candidate for synthesis in organic chemistry and biochemistry. Additionally, it may have applications in the study of metabolic pathways and as a building block in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C6H10O3
InChI:InChI=1S/C6H10O3/c1-4(2)3-5(7)6(8)9/h4H,3H2,1-2H3,(H,8,9)/i6+1
InChI key:InChIKey=BKAJNAXTPSGJCU-PTQBSOBMSA-N
SMILES:C(CC(C)C)([13C](O)=O)=O
Synonyms:- 4-Methyl-2-oxopentanoic-1-13C acid
- Pentanoic-1-13C acid, 4-methyl-2-oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
