CymitQuimica logo

CAS 92755-76-5

:

(1R,2R)-12-fluoro-5-methyl-1,2-dihydrochrysene-1,2-diol

Description:
(1R,2R)-12-fluoro-5-methyl-1,2-dihydrochrysene-1,2-diol is a chemical compound characterized by its specific stereochemistry and functional groups. It features a fluorine atom, which can influence its reactivity and biological activity, as well as hydroxyl groups (-OH) that contribute to its polarity and potential for hydrogen bonding. The presence of a methyl group adds to its hydrophobic character, while the dihydrochrysene structure provides a polycyclic aromatic framework, which may impart unique electronic properties. This compound is likely to exhibit interesting interactions in biological systems, potentially serving as a scaffold for drug development or as a probe in biochemical research. Its stereochemistry, denoted by the (1R,2R) configuration, suggests specific spatial arrangements that can affect its interaction with biological targets. Overall, the combination of these features makes (1R,2R)-12-fluoro-5-methyl-1,2-dihydrochrysene-1,2-diol a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C19H15FO2
InChI:InChI=1/C19H15FO2/c1-10-8-11-4-2-3-5-12(11)14-9-15(20)18-13(17(10)14)6-7-16(21)19(18)22/h2-9,16,19,21-22H,1H3/t16-,19+/m1/s1
Synonyms:
  • 1,2-Chrysenediol, 12-fluoro-1,2-dihydro-5-methyl-, trans-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.