CymitQuimica logo

CAS 92755-77-6

:

(1R,2R)-6-fluoro-11-methyl-1,2-dihydrochrysene-1,2-diol

Description:
(1R,2R)-6-fluoro-11-methyl-1,2-dihydrochrysene-1,2-diol is a polycyclic aromatic compound characterized by its complex structure, which includes a fluorine substituent and hydroxyl groups. This compound features a fused ring system typical of chrysene derivatives, contributing to its stability and potential biological activity. The presence of the fluorine atom can enhance lipophilicity and influence the compound's reactivity and interaction with biological targets. The diol functional groups suggest the potential for hydrogen bonding, which may affect solubility and reactivity in various chemical environments. Additionally, the specific stereochemistry indicated by the (1R,2R) configuration implies that the compound may exhibit unique optical properties and biological activities, making it of interest in medicinal chemistry and material science. Its CAS number, 92755-77-6, allows for easy identification and reference in chemical databases. Overall, this compound's unique structural features may contribute to its potential applications in pharmaceuticals or as a research tool in organic chemistry.
Formula:C19H15FO2
InChI:InChI=1/C19H15FO2/c1-10-8-15-11(6-7-17(21)19(15)22)14-9-16(20)12-4-2-3-5-13(12)18(10)14/h2-9,17,19,21-22H,1H3/t17-,19-/m1/s1
SMILES:Cc1cc2c(C=C[C@H]([C@@H]2O)O)c2cc(c3ccccc3c12)F
Synonyms:
  • 1,2-Chrysenediol, 6-fluoro-1,2-dihydro-11-methyl-, trans-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.