CAS 92758-86-6
:bis(3,5-dichlorophenyl)methanone
Description:
Bis(3,5-dichlorophenyl)methanone, with the CAS number 92758-86-6, is an organic compound characterized by its structure, which features two 3,5-dichlorophenyl groups attached to a central carbonyl (C=O) group. This compound is typically a solid at room temperature and exhibits a crystalline appearance. It is known for its potential applications in various fields, including pharmaceuticals and agrochemicals, due to its reactivity and ability to participate in further chemical transformations. The presence of multiple chlorine substituents on the phenyl rings enhances its lipophilicity and may influence its biological activity. Additionally, the compound's stability and solubility can vary depending on the solvent used. Safety data indicates that, like many chlorinated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, bis(3,5-dichlorophenyl)methanone is a notable compound in organic chemistry, with properties that warrant further investigation for its utility in synthetic applications.
Formula:C13H6Cl4O
InChI:InChI=1/C13H6Cl4O/c14-9-1-7(2-10(15)5-9)13(18)8-3-11(16)6-12(17)4-8/h1-6H
SMILES:c1c(cc(cc1Cl)Cl)C(=O)c1cc(cc(c1)Cl)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.