CAS 92759-90-5

2-[(1-Ethylpentyl)oxy]acetic acid

Description:

2-[(1-Ethylpentyl)oxy]acetic acid, with the CAS number 92759-90-5, is an organic compound characterized by its ether and carboxylic acid functional groups. This substance features a long hydrocarbon chain, which contributes to its hydrophobic properties, while the carboxylic acid group imparts acidity and potential for hydrogen bonding. Typically, compounds of this nature exhibit moderate solubility in organic solvents and limited solubility in water due to the presence of the bulky ethylpentyl group. The compound may be used in various applications, including as a surfactant or in the synthesis of other chemical products. Its structure suggests potential reactivity in esterification or amidation reactions, making it a candidate for further chemical modifications. Safety data should be consulted for handling and usage, as compounds with similar structures can exhibit varying degrees of toxicity or environmental impact. Overall, 2-[(1-Ethylpentyl)oxy]acetic acid represents a class of compounds that bridge hydrophobic and hydrophilic characteristics, making them versatile in chemical applications.

Formula: C₉H₁₈O₃

InChI: InChI=1S/C9H18O3/c1-3-5-6-8(4-2)12-7-9(10)11/h8H,3-7H2,1-2H3,(H,10,11)

InChI key: InChIKey=HIMHBQQZMDPFSB-UHFFFAOYSA-N

SMILES: C(OCC(O)=O)(CCCC)CC

Synonyms:

• Acetic acid, 2-[(1-ethylpentyl)oxy]-
• 2-Heptan-3-yloxyacetic acid
• Acetic acid, [(1-ethylpentyl)oxy]-
• 2-[(1-Ethylpentyl)oxy]acetic acid