CAS 927684-97-7
:7-Quinolinamine, 1,2,3,4-tetrahydro-1-methyl-, hydrochloride (1:1)
Description:
7-Quinolinamine, 1,2,3,4-tetrahydro-1-methyl-, hydrochloride (1:1) is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom in the ring. This specific derivative features a tetrahydro configuration, indicating that it has undergone partial hydrogenation, resulting in a saturated ring system. The presence of a methyl group at the nitrogen position contributes to its basicity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals. The compound may exhibit properties such as antimicrobial or antitumor activity, common among quinoline derivatives. Its CAS number, 927684-97-7, allows for precise identification in chemical databases. Safety and handling precautions should be observed, as with many nitrogen-containing heterocycles, due to potential toxicity or reactivity. Overall, this compound represents a significant class of organic molecules with diverse applications in medicinal chemistry.
Formula:C10H15ClN2
InChI:InChI=1/C10H14N2.ClH/c1-12-6-2-3-8-4-5-9(11)7-10(8)12;/h4-5,7H,2-3,6,11H2,1H3;1H
SMILES:CN1CCCc2ccc(cc12)N.Cl
Synonyms:- 1-Methyl-1,2,3,4-tetrahydro-7-quinolinamine hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
7-Amino-n-methyl-1,2,3,4-tetrahydroquinoline, HCl
CAS:Formula:C10H15ClN2Color and Shape:SolidMolecular weight:198.69257-Amino-N-methyl-1,2,3,4-tetrahydroquinoline hydrochloride
CAS:7-Amino-N-methyl-1,2,3,4-tetrahydroquinoline hydrochloridePurity:95%Molecular weight:198.69g/mol1-Methyl-1,2,3,4-tetrahydroquinolin-7-amine hydrochloride
CAS:<p>1-Methyl-1,2,3,4-tetrahydroquinolin-7-amine hydrochloride (MQ) is a fluorescent probe that has been used to study the photostability of cisplatin in real time. MQ was synthesized by reacting 3-(2'-bromoacetyl)-7-methoxy-1,2,3,4-tetrahydroquinolin with 7-aminoquinaldine. The emission spectrum of MQ peaks at 615 nm and has an extinction coefficient at 615 nm of 12.5 mM/cm. This probe has been shown to be photostable for long periods of time and can be used to visualize DNA polymerase activity in living cells.</p>Formula:C10H15ClN2Purity:Min. 95%Color and Shape:Off-White PowderMolecular weight:198.69 g/mol


