
CAS 92779-75-4
:2-[2-[2-[(1-Butyloctyl)oxy]ethoxy]ethoxy]ethanol
Description:
2-[2-[2-[(1-Butyloctyl)oxy]ethoxy]ethoxy]ethanol, with CAS number 92779-75-4, is a complex organic compound characterized by its multi-ether structure. This substance features a long hydrophobic butyloctyl group, which contributes to its surfactant properties, making it useful in various applications, including as an emulsifier or solubilizer in formulations. The presence of multiple ethoxy groups enhances its solubility in both polar and non-polar solvents, allowing it to interact effectively with a wide range of substances. Additionally, the hydroxyl group (–OH) in its structure provides potential for hydrogen bonding, which can influence its physical properties, such as boiling point and viscosity. This compound is typically colorless to pale yellow and may have a mild odor. Its applications span across industries, including cosmetics, pharmaceuticals, and agrochemicals, where it can improve the stability and performance of products. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C18H38O4
InChI:InChI=1S/C18H38O4/c1-3-5-7-8-9-11-18(10-6-4-2)22-17-16-21-15-14-20-13-12-19/h18-19H,3-17H2,1-2H3
InChI key:InChIKey=DKZQBIOLXNXFEU-UHFFFAOYSA-N
SMILES:C(OCCOCCOCCO)(CCCCCCC)CCCC
Synonyms:- 2-[2-[2-[(1-Butyloctyl)oxy]ethoxy]ethoxy]ethanol
- Ethanol, 2-[2-[2-[(1-butyloctyl)oxy]ethoxy]ethoxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
